C11H15NO2 — CID 82125722
N-[(2,4-dimethylphenyl)methyl]-2-hydroxyacetamide (PubChem CID 82125722) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)methyl]-2-hydroxyacetamide.
| Compound Name | N-[(2,4-dimethylphenyl)methyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 82125722 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-[(2,4-dimethylphenyl)methyl]-2-hydroxyacetamide |
| SMILES | Cc1ccc(CNC(=O)CO)c(C)c1 |
| InChI | InChI=1S/C11H15NO2/c1-8-3-4-10(9(2)5-8)6-12-11(14)7-13/h3-5,13H,6-7H2,1-2H3,(H,12,14) |
| InChIKey | SVLGSGQFWJEOAN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |