About 4-(4-butylphenyl)-1,3-oxazole
4-(4-butylphenyl)-1,3-oxazole (PubChem CID 82126000) has the molecular formula C13H15NO
and a molecular weight of 201.27 g/mol. Its IUPAC name is 4-(4-butylphenyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 4-(4-butylphenyl)-1,3-oxazole |
| PubChem CID | 82126000 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 4-(4-butylphenyl)-1,3-oxazole |
| SMILES | CCCCc1ccc(-c2cocn2)cc1 |
| InChI | InChI=1S/C13H15NO/c1-2-3-4-11-5-7-12(8-6-11)13-9-15-10-14-13/h5-10H,2-4H2,1H3 |
| InChIKey | IUDAZORAXLRGHV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-butylphenyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-butylphenyl)-1,3-oxazole?
The IUPAC name of 4-(4-butylphenyl)-1,3-oxazole (CID 82126000) is 4-(4-butylphenyl)-1,3-oxazole.
What is the SMILES notation for 4-(4-butylphenyl)-1,3-oxazole?
The canonical SMILES for 4-(4-butylphenyl)-1,3-oxazole is CCCCc1ccc(-c2cocn2)cc1.
What is the InChIKey of 4-(4-butylphenyl)-1,3-oxazole?
The InChIKey is IUDAZORAXLRGHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO/c1-2-3-4-11-5-7-12(8-6-11)13-9-15-10-14-13/h5-10H,2-4H2,1H3.
What are the key properties of 4-(4-butylphenyl)-1,3-oxazole?
4-(4-butylphenyl)-1,3-oxazole has a molecular weight of 201.27 g/mol, XLogP of 3.68, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-butylphenyl)-1,3-oxazole is sourced from PubChem (CID 82126000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).