C12H15NO2 — CID 82126298
5-methoxy-4,4-dimethyl-2,3-dihydroisoquinolin-1-one (PubChem CID 82126298) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 5-methoxy-4,4-dimethyl-2,3-dihydroisoquinolin-1-one.
| Compound Name | 5-methoxy-4,4-dimethyl-2,3-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 82126298 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 5-methoxy-4,4-dimethyl-2,3-dihydroisoquinolin-1-one |
| SMILES | COc1cccc2c1C(C)(C)CNC2=O |
| InChI | InChI=1S/C12H15NO2/c1-12(2)7-13-11(14)8-5-4-6-9(15-3)10(8)12/h4-6H,7H2,1-3H3,(H,13,14) |
| InChIKey | GJESPYUFJTWBDJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |