C9H9ClO2S — CID 82127105
1-(5-chlorothiophen-2-yl)pentane-1,4-dione (PubChem CID 82127105) has the molecular formula C9H9ClO2S and a molecular weight of 216.69 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)pentane-1,4-dione.
| Compound Name | 1-(5-chlorothiophen-2-yl)pentane-1,4-dione |
|---|---|
| PubChem CID | 82127105 |
| Molecular Formula | C9H9ClO2S |
| Molecular Weight | 216.69 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)pentane-1,4-dione |
| SMILES | CC(=O)CCC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C9H9ClO2S/c1-6(11)2-3-7(12)8-4-5-9(10)13-8/h4-5H,2-3H2,1H3 |
| InChIKey | NTTBPMRPWILTLZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.69 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |