C11H10ClNO2 — CID 82128057
4-(3-chloro-4-methoxyphenyl)-2-methyl-1,3-oxazole (PubChem CID 82128057) has the molecular formula C11H10ClNO2 and a molecular weight of 223.66 g/mol. Its IUPAC name is 4-(3-chloro-4-methoxyphenyl)-2-methyl-1,3-oxazole.
| Compound Name | 4-(3-chloro-4-methoxyphenyl)-2-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 82128057 |
| Molecular Formula | C11H10ClNO2 |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 4-(3-chloro-4-methoxyphenyl)-2-methyl-1,3-oxazole |
| SMILES | COc1ccc(-c2coc(C)n2)cc1Cl |
| InChI | InChI=1S/C11H10ClNO2/c1-7-13-10(6-15-7)8-3-4-11(14-2)9(12)5-8/h3-6H,1-2H3 |
| InChIKey | ZFWNPYHZUZAKJX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |