About 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid
3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid (PubChem CID 82128077) has the molecular formula C9H8N2O3S
and a molecular weight of 224.24 g/mol. Its IUPAC name is 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid.
Analyze 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid?
The IUPAC name of 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid (CID 82128077) is 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid.
What is the SMILES notation for 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid?
The canonical SMILES for 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid is Cc1csc2nc(C(=O)O)n(C)c(=O)c12.
What is the InChIKey of 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid?
The InChIKey is LZBXCVJHIRTWCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3S/c1-4-3-15-7-5(4)8(12)11(2)6(10-7)9(13)14/h3H,1-2H3,(H,13,14).
What are the key properties of 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid?
3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid has a molecular weight of 224.24 g/mol, XLogP of 1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid is sourced from PubChem (CID 82128077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).