3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid

C9H8N2O3S — CID 82128077

IUPAC3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid
SMILESCc1csc2nc(C(=O)O)n(C)c(=O)c12
InChIInChI=1S/C9H8N2O3S/c1-4-3-15-7-5(4)8(12)11(2)6(10-7)9(13)14/h3H,1-2H3,(H,13,14)
InChIKeyLZBXCVJHIRTWCR-UHFFFAOYSA-N
MW224.24 g/mol
LogP1.00
Rot. Bonds1

About 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid

3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid (PubChem CID 82128077) has the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. Its IUPAC name is 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid.

Molecular Properties

Compound Name3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid
PubChem CID82128077
Molecular FormulaC9H8N2O3S
Molecular Weight224.24 g/mol
Exact Mass224.03
IUPAC Name3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid
SMILESCc1csc2nc(C(=O)O)n(C)c(=O)c12
InChIInChI=1S/C9H8N2O3S/c1-4-3-15-7-5(4)8(12)11(2)6(10-7)9(13)14/h3H,1-2H3,(H,13,14)
InChIKeyLZBXCVJHIRTWCR-UHFFFAOYSA-N
XLogP1.00
TPSA72.19 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.24
LogP ≤ 51.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid?
The IUPAC name of 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid (CID 82128077) is 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid.
What is the SMILES notation for 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid?
The canonical SMILES for 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid is Cc1csc2nc(C(=O)O)n(C)c(=O)c12.
What is the InChIKey of 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid?
The InChIKey is LZBXCVJHIRTWCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3S/c1-4-3-15-7-5(4)8(12)11(2)6(10-7)9(13)14/h3H,1-2H3,(H,13,14).
What are the key properties of 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid?
3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid has a molecular weight of 224.24 g/mol, XLogP of 1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-carboxylic acid is sourced from PubChem (CID 82128077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).