About 4-(aminomethyl)-6,8-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one
4-(aminomethyl)-6,8-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 82129525) has the molecular formula C12H16N2O3
and a molecular weight of 236.27 g/mol. Its IUPAC name is 4-(aminomethyl)-6,8-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 4-(aminomethyl)-6,8-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one |
| PubChem CID | 82129525 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 4-(aminomethyl)-6,8-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | COc1cc(OC)c2c(c1)C(CN)CNC2=O |
| InChI | InChI=1S/C12H16N2O3/c1-16-8-3-9-7(5-13)6-14-12(15)11(9)10(4-8)17-2/h3-4,7H,5-6,13H2,1-2H3,(H,14,15) |
| InChIKey | PSERWBRQJRSHBO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(aminomethyl)-6,8-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-6,8-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one?
The IUPAC name of 4-(aminomethyl)-6,8-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one (CID 82129525) is 4-(aminomethyl)-6,8-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one.
What is the SMILES notation for 4-(aminomethyl)-6,8-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one?
The canonical SMILES for 4-(aminomethyl)-6,8-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one is COc1cc(OC)c2c(c1)C(CN)CNC2=O.
What is the InChIKey of 4-(aminomethyl)-6,8-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one?
The InChIKey is PSERWBRQJRSHBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3/c1-16-8-3-9-7(5-13)6-14-12(15)11(9)10(4-8)17-2/h3-4,7H,5-6,13H2,1-2H3,(H,14,15).
What are the key properties of 4-(aminomethyl)-6,8-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one?
4-(aminomethyl)-6,8-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one has a molecular weight of 236.27 g/mol, XLogP of 0.49, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-6,8-dimethoxy-3,4-dihydro-2H-isoquinolin-1-one is sourced from PubChem (CID 82129525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).