C12H12ClNO2 — CID 82129732
1-[(3-chlorophenyl)methyl]piperidine-2,6-dione (PubChem CID 82129732) has the molecular formula C12H12ClNO2 and a molecular weight of 237.69 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]piperidine-2,6-dione.
| Compound Name | 1-[(3-chlorophenyl)methyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 82129732 |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]piperidine-2,6-dione |
| SMILES | O=C1CCCC(=O)N1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H12ClNO2/c13-10-4-1-3-9(7-10)8-14-11(15)5-2-6-12(14)16/h1,3-4,7H,2,5-6,8H2 |
| InChIKey | LEGXOOQWRSNMGJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|