C11H9ClN2O3 — CID 82131774
1-(2-chlorophenyl)-4-(hydroxymethyl)pyrazole-3-carboxylic acid (PubChem CID 82131774) has the molecular formula C11H9ClN2O3 and a molecular weight of 252.66 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-4-(hydroxymethyl)pyrazole-3-carboxylic acid.
| Compound Name | 1-(2-chlorophenyl)-4-(hydroxymethyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 82131774 |
| Molecular Formula | C11H9ClN2O3 |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 1-(2-chlorophenyl)-4-(hydroxymethyl)pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1nn(-c2ccccc2Cl)cc1CO |
| InChI | InChI=1S/C11H9ClN2O3/c12-8-3-1-2-4-9(8)14-5-7(6-15)10(13-14)11(16)17/h1-5,15H,6H2,(H,16,17) |
| InChIKey | NODMKDLXBVBWSN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |