C15H16ClNO — CID 82133164
5-chloro-2-[(2,4-dimethylphenyl)methoxy]aniline (PubChem CID 82133164) has the molecular formula C15H16ClNO and a molecular weight of 261.75 g/mol. Its IUPAC name is 5-chloro-2-[(2,4-dimethylphenyl)methoxy]aniline.
| Compound Name | 5-chloro-2-[(2,4-dimethylphenyl)methoxy]aniline |
|---|---|
| PubChem CID | 82133164 |
| Molecular Formula | C15H16ClNO |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 5-chloro-2-[(2,4-dimethylphenyl)methoxy]aniline |
| SMILES | Cc1ccc(COc2ccc(Cl)cc2N)c(C)c1 |
| InChI | InChI=1S/C15H16ClNO/c1-10-3-4-12(11(2)7-10)9-18-15-6-5-13(16)8-14(15)17/h3-8H,9,17H2,1-2H3 |
| InChIKey | PIGGEDGBDGNUDQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|