C14H16O5 — CID 82133552
4-(2,5-dimethoxyphenyl)-4-methyloxane-2,6-dione (PubChem CID 82133552) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-4-methyloxane-2,6-dione.
| Compound Name | 4-(2,5-dimethoxyphenyl)-4-methyloxane-2,6-dione |
|---|---|
| PubChem CID | 82133552 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-4-methyloxane-2,6-dione |
| SMILES | COc1ccc(OC)c(C2(C)CC(=O)OC(=O)C2)c1 |
| InChI | InChI=1S/C14H16O5/c1-14(7-12(15)19-13(16)8-14)10-6-9(17-2)4-5-11(10)18-3/h4-6H,7-8H2,1-3H3 |
| InChIKey | JOIVUKGKELXZIM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|