C16H25FN2O2 — CID 82135943
1-(3-amino-4-fluorophenyl)-3-[2-(2-hydroxyethyl)piperidin-1-yl]propan-1-ol (PubChem CID 82135943) has the molecular formula C16H25FN2O2 and a molecular weight of 296.39 g/mol. Its IUPAC name is 1-(3-amino-4-fluorophenyl)-3-[2-(2-hydroxyethyl)piperidin-1-yl]propan-1-ol.
| Compound Name | 1-(3-amino-4-fluorophenyl)-3-[2-(2-hydroxyethyl)piperidin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 82135943 |
| Molecular Formula | C16H25FN2O2 |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 1-(3-amino-4-fluorophenyl)-3-[2-(2-hydroxyethyl)piperidin-1-yl]propan-1-ol |
| SMILES | Nc1cc(C(O)CCN2CCCCC2CCO)ccc1F |
| InChI | InChI=1S/C16H25FN2O2/c17-14-5-4-12(11-15(14)18)16(21)6-9-19-8-2-1-3-13(19)7-10-20/h4-5,11,13,16,20-21H,1-3,6-10,18H2 |
| InChIKey | UUPIGMWQAZGJSH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|