C18H22FNO — CID 82138304
2-(3-fluorophenyl)-5-(2-methylphenoxy)pentan-1-amine (PubChem CID 82138304) has the molecular formula C18H22FNO and a molecular weight of 287.38 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-5-(2-methylphenoxy)pentan-1-amine.
| Compound Name | 2-(3-fluorophenyl)-5-(2-methylphenoxy)pentan-1-amine |
|---|---|
| PubChem CID | 82138304 |
| Molecular Formula | C18H22FNO |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-(3-fluorophenyl)-5-(2-methylphenoxy)pentan-1-amine |
| SMILES | Cc1ccccc1OCCCC(CN)c1cccc(F)c1 |
| InChI | InChI=1S/C18H22FNO/c1-14-6-2-3-10-18(14)21-11-5-8-16(13-20)15-7-4-9-17(19)12-15/h2-4,6-7,9-10,12,16H,5,8,11,13,20H2,1H3 |
| InChIKey | GVGSMXKIJBXMBO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|