About 3-(2-chlorophenyl)-2-cyano-N,N-dipropylpropanamide
3-(2-chlorophenyl)-2-cyano-N,N-dipropylpropanamide (PubChem CID 82139408) has the molecular formula C16H21ClN2O
and a molecular weight of 292.81 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-2-cyano-N,N-dipropylpropanamide.
Molecular Properties
| Compound Name | 3-(2-chlorophenyl)-2-cyano-N,N-dipropylpropanamide |
| PubChem CID | 82139408 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-(2-chlorophenyl)-2-cyano-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)C(C#N)Cc1ccccc1Cl |
| InChI | InChI=1S/C16H21ClN2O/c1-3-9-19(10-4-2)16(20)14(12-18)11-13-7-5-6-8-15(13)17/h5-8,14H,3-4,9-11H2,1-2H3 |
| InChIKey | PILWMKOXZZNZKL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-chlorophenyl)-2-cyano-N,N-dipropylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chlorophenyl)-2-cyano-N,N-dipropylpropanamide?
The IUPAC name of 3-(2-chlorophenyl)-2-cyano-N,N-dipropylpropanamide (CID 82139408) is 3-(2-chlorophenyl)-2-cyano-N,N-dipropylpropanamide.
What is the SMILES notation for 3-(2-chlorophenyl)-2-cyano-N,N-dipropylpropanamide?
The canonical SMILES for 3-(2-chlorophenyl)-2-cyano-N,N-dipropylpropanamide is CCCN(CCC)C(=O)C(C#N)Cc1ccccc1Cl.
What is the InChIKey of 3-(2-chlorophenyl)-2-cyano-N,N-dipropylpropanamide?
The InChIKey is PILWMKOXZZNZKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21ClN2O/c1-3-9-19(10-4-2)16(20)14(12-18)11-13-7-5-6-8-15(13)17/h5-8,14H,3-4,9-11H2,1-2H3.
What are the key properties of 3-(2-chlorophenyl)-2-cyano-N,N-dipropylpropanamide?
3-(2-chlorophenyl)-2-cyano-N,N-dipropylpropanamide has a molecular weight of 292.81 g/mol, XLogP of 3.67, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chlorophenyl)-2-cyano-N,N-dipropylpropanamide is sourced from PubChem (CID 82139408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).