C17H19ClFNO2 — CID 82139834
3-(2-chloro-6-fluorophenyl)-2-(2,5-dimethoxyphenyl)propan-1-amine (PubChem CID 82139834) has the molecular formula C17H19ClFNO2 and a molecular weight of 323.80 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-2-(2,5-dimethoxyphenyl)propan-1-amine.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-2-(2,5-dimethoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 82139834 |
| Molecular Formula | C17H19ClFNO2 |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-2-(2,5-dimethoxyphenyl)propan-1-amine |
| SMILES | COc1ccc(OC)c(C(CN)Cc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C17H19ClFNO2/c1-21-12-6-7-17(22-2)13(9-12)11(10-20)8-14-15(18)4-3-5-16(14)19/h3-7,9,11H,8,10,20H2,1-2H3 |
| InChIKey | GZIDBPGRSRVMMA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |