About 3-(3,4-dichlorophenyl)-2-methyl-2-phenylpropanenitrile
3-(3,4-dichlorophenyl)-2-methyl-2-phenylpropanenitrile (PubChem CID 82140043) has the molecular formula C16H13Cl2N
and a molecular weight of 290.19 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-2-methyl-2-phenylpropanenitrile.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenyl)-2-methyl-2-phenylpropanenitrile |
| PubChem CID | 82140043 |
| Molecular Formula | C16H13Cl2N |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-2-methyl-2-phenylpropanenitrile |
| SMILES | CC(C#N)(Cc1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C16H13Cl2N/c1-16(11-19,13-5-3-2-4-6-13)10-12-7-8-14(17)15(18)9-12/h2-9H,10H2,1H3 |
| InChIKey | YAPBRCPFYXHOQN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(3,4-dichlorophenyl)-2-methyl-2-phenylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenyl)-2-methyl-2-phenylpropanenitrile?
The IUPAC name of 3-(3,4-dichlorophenyl)-2-methyl-2-phenylpropanenitrile (CID 82140043) is 3-(3,4-dichlorophenyl)-2-methyl-2-phenylpropanenitrile.
What is the SMILES notation for 3-(3,4-dichlorophenyl)-2-methyl-2-phenylpropanenitrile?
The canonical SMILES for 3-(3,4-dichlorophenyl)-2-methyl-2-phenylpropanenitrile is CC(C#N)(Cc1ccc(Cl)c(Cl)c1)c1ccccc1.
What is the InChIKey of 3-(3,4-dichlorophenyl)-2-methyl-2-phenylpropanenitrile?
The InChIKey is YAPBRCPFYXHOQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Cl2N/c1-16(11-19,13-5-3-2-4-6-13)10-12-7-8-14(17)15(18)9-12/h2-9H,10H2,1H3.
What are the key properties of 3-(3,4-dichlorophenyl)-2-methyl-2-phenylpropanenitrile?
3-(3,4-dichlorophenyl)-2-methyl-2-phenylpropanenitrile has a molecular weight of 290.19 g/mol, XLogP of 5.02, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenyl)-2-methyl-2-phenylpropanenitrile is sourced from PubChem (CID 82140043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).