C8H8O4 — CID 821411
3-ethyl-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione (PubChem CID 821411) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is 3-ethyl-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 3-ethyl-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 821411 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 3-ethyl-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
| SMILES | CCC1=C(O)C(=O)C=C(O)C1=O |
| InChI | InChI=1S/C8H8O4/c1-2-4-7(11)5(9)3-6(10)8(4)12/h3,9,12H,2H2,1H3 |
| InChIKey | WJSQCAWGGRFZJK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|