C18H26N2O2 — CID 82142178
2-[2-tert-butyl-1-(3-methylbutyl)benzimidazol-5-yl]acetic acid (PubChem CID 82142178) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-[2-tert-butyl-1-(3-methylbutyl)benzimidazol-5-yl]acetic acid.
| Compound Name | 2-[2-tert-butyl-1-(3-methylbutyl)benzimidazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 82142178 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 2-[2-tert-butyl-1-(3-methylbutyl)benzimidazol-5-yl]acetic acid |
| SMILES | CC(C)CCn1c(C(C)(C)C)nc2cc(CC(=O)O)ccc21 |
| InChI | InChI=1S/C18H26N2O2/c1-12(2)8-9-20-15-7-6-13(11-16(21)22)10-14(15)19-17(20)18(3,4)5/h6-7,10,12H,8-9,11H2,1-5H3,(H,21,22) |
| InChIKey | JZFRGMWWBARVDY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |