C15H22N2O2 — CID 82142321
4-(2-aminoethyl)-6-tert-butyl-2-methyl-1,4-benzoxazin-3-one (PubChem CID 82142321) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 4-(2-aminoethyl)-6-tert-butyl-2-methyl-1,4-benzoxazin-3-one.
| Compound Name | 4-(2-aminoethyl)-6-tert-butyl-2-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82142321 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 4-(2-aminoethyl)-6-tert-butyl-2-methyl-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccc(C(C)(C)C)cc2N(CCN)C1=O |
| InChI | InChI=1S/C15H22N2O2/c1-10-14(18)17(8-7-16)12-9-11(15(2,3)4)5-6-13(12)19-10/h5-6,9-10H,7-8,16H2,1-4H3 |
| InChIKey | GSRJNIWQICSJID-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |