About 2-(6-ethyl-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-2-methylpropanoic acid
2-(6-ethyl-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-2-methylpropanoic acid (PubChem CID 82142762) has the molecular formula C16H21NO4
and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-(6-ethyl-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 2-(6-ethyl-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-2-methylpropanoic acid |
| PubChem CID | 82142762 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-(6-ethyl-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-2-methylpropanoic acid |
| SMILES | CCc1ccc2c(c1)N(C(C)(C)C(=O)O)C(=O)C(C)(C)O2 |
| InChI | InChI=1S/C16H21NO4/c1-6-10-7-8-12-11(9-10)17(15(2,3)14(19)20)13(18)16(4,5)21-12/h7-9H,6H2,1-5H3,(H,19,20) |
| InChIKey | RAWAGPOZMSECJY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6-ethyl-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-ethyl-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-2-methylpropanoic acid?
The IUPAC name of 2-(6-ethyl-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-2-methylpropanoic acid (CID 82142762) is 2-(6-ethyl-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-2-methylpropanoic acid.
What is the SMILES notation for 2-(6-ethyl-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-2-methylpropanoic acid?
The canonical SMILES for 2-(6-ethyl-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-2-methylpropanoic acid is CCc1ccc2c(c1)N(C(C)(C)C(=O)O)C(=O)C(C)(C)O2.
What is the InChIKey of 2-(6-ethyl-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-2-methylpropanoic acid?
The InChIKey is RAWAGPOZMSECJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO4/c1-6-10-7-8-12-11(9-10)17(15(2,3)14(19)20)13(18)16(4,5)21-12/h7-9H,6H2,1-5H3,(H,19,20).
What are the key properties of 2-(6-ethyl-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-2-methylpropanoic acid?
2-(6-ethyl-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-2-methylpropanoic acid has a molecular weight of 291.35 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-ethyl-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-2-methylpropanoic acid is sourced from PubChem (CID 82142762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).