C10H12N2O2 — CID 82143490
3-(3-ethoxy-2-oxo-1-pyridinyl)propanenitrile (PubChem CID 82143490) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 3-(3-ethoxy-2-oxo-1-pyridinyl)propanenitrile.
| Compound Name | 3-(3-ethoxy-2-oxo-1-pyridinyl)propanenitrile |
|---|---|
| PubChem CID | 82143490 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 3-(3-ethoxy-2-oxo-1-pyridinyl)propanenitrile |
| SMILES | CCOc1cccn(CCC#N)c1=O |
| InChI | InChI=1S/C10H12N2O2/c1-2-14-9-5-3-7-12(10(9)13)8-4-6-11/h3,5,7H,2,4,8H2,1H3 |
| InChIKey | OPJJNIBLIDOKEU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |