C12H18N2O2 — CID 82144130
3-acetyl-1-(2-aminobutyl)-6-methylpyridin-2-one (PubChem CID 82144130) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-acetyl-1-(2-aminobutyl)-6-methylpyridin-2-one.
| Compound Name | 3-acetyl-1-(2-aminobutyl)-6-methylpyridin-2-one |
|---|---|
| PubChem CID | 82144130 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 3-acetyl-1-(2-aminobutyl)-6-methylpyridin-2-one |
| SMILES | CCC(N)Cn1c(C)ccc(C(C)=O)c1=O |
| InChI | InChI=1S/C12H18N2O2/c1-4-10(13)7-14-8(2)5-6-11(9(3)15)12(14)16/h5-6,10H,4,7,13H2,1-3H3 |
| InChIKey | YTWPEUONBQKHJM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |