C10H12ClF3N2O — CID 82144141
1-(2-amino-2-methylpropyl)-3-chloro-5-(trifluoromethyl)pyridin-2-one (PubChem CID 82144141) has the molecular formula C10H12ClF3N2O and a molecular weight of 268.67 g/mol. Its IUPAC name is 1-(2-amino-2-methylpropyl)-3-chloro-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-(2-amino-2-methylpropyl)-3-chloro-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 82144141 |
| Molecular Formula | C10H12ClF3N2O |
| Molecular Weight | 268.67 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 1-(2-amino-2-methylpropyl)-3-chloro-5-(trifluoromethyl)pyridin-2-one |
| SMILES | CC(C)(N)Cn1cc(C(F)(F)F)cc(Cl)c1=O |
| InChI | InChI=1S/C10H12ClF3N2O/c1-9(2,15)5-16-4-6(10(12,13)14)3-7(11)8(16)17/h3-4H,5,15H2,1-2H3 |
| InChIKey | JJTQGKAHYMHUJW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.67 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |