About 3-(6-cyclopropyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)-2-methylpropanenitrile
3-(6-cyclopropyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)-2-methylpropanenitrile (PubChem CID 82145632) has the molecular formula C15H15N3O2
and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-(6-cyclopropyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)-2-methylpropanenitrile.
Molecular Properties
| Compound Name | 3-(6-cyclopropyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)-2-methylpropanenitrile |
| PubChem CID | 82145632 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-(6-cyclopropyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)-2-methylpropanenitrile |
| SMILES | CC(C#N)Cn1c(C2CC2)nc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C15H15N3O2/c1-9(6-16)7-18-12-5-14-13(19-8-20-14)4-11(12)17-15(18)10-2-3-10/h4-5,9-10H,2-3,7-8H2,1H3 |
| InChIKey | VXXKSFUUAWHEJQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(6-cyclopropyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)-2-methylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-cyclopropyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)-2-methylpropanenitrile?
The IUPAC name of 3-(6-cyclopropyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)-2-methylpropanenitrile (CID 82145632) is 3-(6-cyclopropyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)-2-methylpropanenitrile.
What is the SMILES notation for 3-(6-cyclopropyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)-2-methylpropanenitrile?
The canonical SMILES for 3-(6-cyclopropyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)-2-methylpropanenitrile is CC(C#N)Cn1c(C2CC2)nc2cc3c(cc21)OCO3.
What is the InChIKey of 3-(6-cyclopropyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)-2-methylpropanenitrile?
The InChIKey is VXXKSFUUAWHEJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O2/c1-9(6-16)7-18-12-5-14-13(19-8-20-14)4-11(12)17-15(18)10-2-3-10/h4-5,9-10H,2-3,7-8H2,1H3.
What are the key properties of 3-(6-cyclopropyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)-2-methylpropanenitrile?
3-(6-cyclopropyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)-2-methylpropanenitrile has a molecular weight of 269.30 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-cyclopropyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)-2-methylpropanenitrile is sourced from PubChem (CID 82145632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).