C14H17F2N3 — CID 82146329
2-(2-cyclobutyl-5,6-difluorobenzimidazol-1-yl)propan-1-amine (PubChem CID 82146329) has the molecular formula C14H17F2N3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-(2-cyclobutyl-5,6-difluorobenzimidazol-1-yl)propan-1-amine.
| Compound Name | 2-(2-cyclobutyl-5,6-difluorobenzimidazol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 82146329 |
| Molecular Formula | C14H17F2N3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 2-(2-cyclobutyl-5,6-difluorobenzimidazol-1-yl)propan-1-amine |
| SMILES | CC(CN)n1c(C2CCC2)nc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C14H17F2N3/c1-8(7-17)19-13-6-11(16)10(15)5-12(13)18-14(19)9-3-2-4-9/h5-6,8-9H,2-4,7,17H2,1H3 |
| InChIKey | WFQYHMMHYKTGDG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |