C11H15N3O — CID 82146932
1-(2-amino-2-methylpropyl)-6-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 82146932) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-(2-amino-2-methylpropyl)-6-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-(2-amino-2-methylpropyl)-6-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 82146932 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 1-(2-amino-2-methylpropyl)-6-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | Cc1ccc(C#N)c(=O)n1CC(C)(C)N |
| InChI | InChI=1S/C11H15N3O/c1-8-4-5-9(6-12)10(15)14(8)7-11(2,3)13/h4-5H,7,13H2,1-3H3 |
| InChIKey | MUZNSJNENZFBRK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |