C14H18N4O2 — CID 82147344
1-(2-piperidin-2-ylethyl)-[1,3]dioxolo[4,5-f]benzotriazole (PubChem CID 82147344) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-(2-piperidin-2-ylethyl)-[1,3]dioxolo[4,5-f]benzotriazole.
| Compound Name | 1-(2-piperidin-2-ylethyl)-[1,3]dioxolo[4,5-f]benzotriazole |
|---|---|
| PubChem CID | 82147344 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-(2-piperidin-2-ylethyl)-[1,3]dioxolo[4,5-f]benzotriazole |
| SMILES | c1c2c(cc3c1nnn3CCC1CCCCN1)OCO2 |
| InChI | InChI=1S/C14H18N4O2/c1-2-5-15-10(3-1)4-6-18-12-8-14-13(19-9-20-14)7-11(12)16-17-18/h7-8,10,15H,1-6,9H2 |
| InChIKey | KMODXKGTRSNEGC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |