C12H17N3OS2 — CID 82147787
2-(2-amino-2-ethylbutyl)sulfanyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 82147787) has the molecular formula C12H17N3OS2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 2-(2-amino-2-ethylbutyl)sulfanyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(2-amino-2-ethylbutyl)sulfanyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 82147787 |
| Molecular Formula | C12H17N3OS2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-(2-amino-2-ethylbutyl)sulfanyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCC(N)(CC)CSc1nc2sccc2c(=O)[nH]1 |
| InChI | InChI=1S/C12H17N3OS2/c1-3-12(13,4-2)7-18-11-14-9(16)8-5-6-17-10(8)15-11/h5-6H,3-4,7,13H2,1-2H3,(H,14,15,16) |
| InChIKey | RYKBKQWFNPLFEI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |