C14H15N3O3 — CID 82148222
3-[4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-2-methylpropanenitrile (PubChem CID 82148222) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 3-[4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-2-methylpropanenitrile.
| Compound Name | 3-[4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 82148222 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 3-[4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-2-methylpropanenitrile |
| SMILES | COc1ccc(C2NC(=O)N(CC(C)C#N)C2=O)cc1 |
| InChI | InChI=1S/C14H15N3O3/c1-9(7-15)8-17-13(18)12(16-14(17)19)10-3-5-11(20-2)6-4-10/h3-6,9,12H,8H2,1-2H3,(H,16,19) |
| InChIKey | SWRZTCMMQJMUQR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|