C11H15N3O3 — CID 82148391
3-(1-aminopropan-2-yl)-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione (PubChem CID 82148391) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 3-(1-aminopropan-2-yl)-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-(1-aminopropan-2-yl)-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 82148391 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 3-(1-aminopropan-2-yl)-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC(CN)N1C(=O)NC(C)(c2ccco2)C1=O |
| InChI | InChI=1S/C11H15N3O3/c1-7(6-12)14-9(15)11(2,13-10(14)16)8-4-3-5-17-8/h3-5,7H,6,12H2,1-2H3,(H,13,16) |
| InChIKey | MYUDUWWAXMXDQA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|