C12H20N4O3S — CID 82148934
2-[8-(3-hydroxypropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]ethanethioamide (PubChem CID 82148934) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-[8-(3-hydroxypropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]ethanethioamide.
| Compound Name | 2-[8-(3-hydroxypropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]ethanethioamide |
|---|---|
| PubChem CID | 82148934 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-[8-(3-hydroxypropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]ethanethioamide |
| SMILES | NC(=S)CN1C(=O)NC2(CCN(CCCO)CC2)C1=O |
| InChI | InChI=1S/C12H20N4O3S/c13-9(20)8-16-10(18)12(14-11(16)19)2-5-15(6-3-12)4-1-7-17/h17H,1-8H2,(H2,13,20)(H,14,19) |
| InChIKey | QLCYYWZLPKBUGA-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|