C12H19N3O4 — CID 82149091
2-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)-3-methylbutanoic acid (PubChem CID 82149091) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)-3-methylbutanoic acid.
| Compound Name | 2-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 82149091 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)N1C(=O)NC2(CCNCC2)C1=O |
| InChI | InChI=1S/C12H19N3O4/c1-7(2)8(9(16)17)15-10(18)12(14-11(15)19)3-5-13-6-4-12/h7-8,13H,3-6H2,1-2H3,(H,14,19)(H,16,17) |
| InChIKey | YRAGXSFSTULQFC-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|