About 2-(6-methyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)ethanol
2-(6-methyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)ethanol (PubChem CID 82149388) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-(6-methyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)ethanol.
Molecular Properties
| Compound Name | 2-(6-methyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)ethanol |
| PubChem CID | 82149388 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-(6-methyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)ethanol |
| SMILES | Cc1nc2cc3c(cc2n1CCO)OCO3 |
| InChI | InChI=1S/C11H12N2O3/c1-7-12-8-4-10-11(16-6-15-10)5-9(8)13(7)2-3-14/h4-5,14H,2-3,6H2,1H3 |
| InChIKey | PJDRRFXNJSJPRO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(6-methyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)ethanol?
The IUPAC name of 2-(6-methyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)ethanol (CID 82149388) is 2-(6-methyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)ethanol.
What is the SMILES notation for 2-(6-methyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)ethanol?
The canonical SMILES for 2-(6-methyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)ethanol is Cc1nc2cc3c(cc2n1CCO)OCO3.
What is the InChIKey of 2-(6-methyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)ethanol?
The InChIKey is PJDRRFXNJSJPRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3/c1-7-12-8-4-10-11(16-6-15-10)5-9(8)13(7)2-3-14/h4-5,14H,2-3,6H2,1H3.
What are the key properties of 2-(6-methyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)ethanol?
2-(6-methyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)ethanol has a molecular weight of 220.23 g/mol, XLogP of 1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)ethanol is sourced from PubChem (CID 82149388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).