About 6-methyl-7-(piperidin-4-ylmethyl)-[1,3]dioxolo[4,5-f]benzimidazole
6-methyl-7-(piperidin-4-ylmethyl)-[1,3]dioxolo[4,5-f]benzimidazole (PubChem CID 82149708) has the molecular formula C15H19N3O2
and a molecular weight of 273.34 g/mol. Its IUPAC name is 6-methyl-7-(piperidin-4-ylmethyl)-[1,3]dioxolo[4,5-f]benzimidazole.
Molecular Properties
| Compound Name | 6-methyl-7-(piperidin-4-ylmethyl)-[1,3]dioxolo[4,5-f]benzimidazole |
| PubChem CID | 82149708 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 6-methyl-7-(piperidin-4-ylmethyl)-[1,3]dioxolo[4,5-f]benzimidazole |
| SMILES | Cc1nc2cc3c(cc2n1CC1CCNCC1)OCO3 |
| InChI | InChI=1S/C15H19N3O2/c1-10-17-12-6-14-15(20-9-19-14)7-13(12)18(10)8-11-2-4-16-5-3-11/h6-7,11,16H,2-5,8-9H2,1H3 |
| InChIKey | ANJWHKGAGAHLAT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methyl-7-(piperidin-4-ylmethyl)-[1,3]dioxolo[4,5-f]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-7-(piperidin-4-ylmethyl)-[1,3]dioxolo[4,5-f]benzimidazole?
The IUPAC name of 6-methyl-7-(piperidin-4-ylmethyl)-[1,3]dioxolo[4,5-f]benzimidazole (CID 82149708) is 6-methyl-7-(piperidin-4-ylmethyl)-[1,3]dioxolo[4,5-f]benzimidazole.
What is the SMILES notation for 6-methyl-7-(piperidin-4-ylmethyl)-[1,3]dioxolo[4,5-f]benzimidazole?
The canonical SMILES for 6-methyl-7-(piperidin-4-ylmethyl)-[1,3]dioxolo[4,5-f]benzimidazole is Cc1nc2cc3c(cc2n1CC1CCNCC1)OCO3.
What is the InChIKey of 6-methyl-7-(piperidin-4-ylmethyl)-[1,3]dioxolo[4,5-f]benzimidazole?
The InChIKey is ANJWHKGAGAHLAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2/c1-10-17-12-6-14-15(20-9-19-14)7-13(12)18(10)8-11-2-4-16-5-3-11/h6-7,11,16H,2-5,8-9H2,1H3.
What are the key properties of 6-methyl-7-(piperidin-4-ylmethyl)-[1,3]dioxolo[4,5-f]benzimidazole?
6-methyl-7-(piperidin-4-ylmethyl)-[1,3]dioxolo[4,5-f]benzimidazole has a molecular weight of 273.34 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-7-(piperidin-4-ylmethyl)-[1,3]dioxolo[4,5-f]benzimidazole is sourced from PubChem (CID 82149708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).