C17H25N3O2 — CID 82149776
2-ethyl-5,6-dimethoxy-1-(piperidin-3-ylmethyl)benzimidazole (PubChem CID 82149776) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-ethyl-5,6-dimethoxy-1-(piperidin-3-ylmethyl)benzimidazole.
| Compound Name | 2-ethyl-5,6-dimethoxy-1-(piperidin-3-ylmethyl)benzimidazole |
|---|---|
| PubChem CID | 82149776 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 2-ethyl-5,6-dimethoxy-1-(piperidin-3-ylmethyl)benzimidazole |
| SMILES | CCc1nc2cc(OC)c(OC)cc2n1CC1CCCNC1 |
| InChI | InChI=1S/C17H25N3O2/c1-4-17-19-13-8-15(21-2)16(22-3)9-14(13)20(17)11-12-6-5-7-18-10-12/h8-9,12,18H,4-7,10-11H2,1-3H3 |
| InChIKey | AHSBIZXDMDXUBJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |