C16H21F2N3 — CID 82149978
2-ethyl-5,6-difluoro-1-(2-piperidin-2-ylethyl)benzimidazole (PubChem CID 82149978) has the molecular formula C16H21F2N3 and a molecular weight of 293.36 g/mol. Its IUPAC name is 2-ethyl-5,6-difluoro-1-(2-piperidin-2-ylethyl)benzimidazole.
| Compound Name | 2-ethyl-5,6-difluoro-1-(2-piperidin-2-ylethyl)benzimidazole |
|---|---|
| PubChem CID | 82149978 |
| Molecular Formula | C16H21F2N3 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-ethyl-5,6-difluoro-1-(2-piperidin-2-ylethyl)benzimidazole |
| SMILES | CCc1nc2cc(F)c(F)cc2n1CCC1CCCCN1 |
| InChI | InChI=1S/C16H21F2N3/c1-2-16-20-14-9-12(17)13(18)10-15(14)21(16)8-6-11-5-3-4-7-19-11/h9-11,19H,2-8H2,1H3 |
| InChIKey | HUNKYANJHMYXNH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |