About 2-[2-(3,4-dimethylphenyl)-6-methylimidazo[4,5-b]pyridin-3-yl]ethanol
2-[2-(3,4-dimethylphenyl)-6-methylimidazo[4,5-b]pyridin-3-yl]ethanol (PubChem CID 82150776) has the molecular formula C17H19N3O
and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-[2-(3,4-dimethylphenyl)-6-methylimidazo[4,5-b]pyridin-3-yl]ethanol.
Molecular Properties
| Compound Name | 2-[2-(3,4-dimethylphenyl)-6-methylimidazo[4,5-b]pyridin-3-yl]ethanol |
| PubChem CID | 82150776 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-[2-(3,4-dimethylphenyl)-6-methylimidazo[4,5-b]pyridin-3-yl]ethanol |
| SMILES | Cc1cnc2c(c1)nc(-c1ccc(C)c(C)c1)n2CCO |
| InChI | InChI=1S/C17H19N3O/c1-11-8-15-17(18-10-11)20(6-7-21)16(19-15)14-5-4-12(2)13(3)9-14/h4-5,8-10,21H,6-7H2,1-3H3 |
| InChIKey | CYYUEKWTFSILGE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(3,4-dimethylphenyl)-6-methylimidazo[4,5-b]pyridin-3-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,4-dimethylphenyl)-6-methylimidazo[4,5-b]pyridin-3-yl]ethanol?
The IUPAC name of 2-[2-(3,4-dimethylphenyl)-6-methylimidazo[4,5-b]pyridin-3-yl]ethanol (CID 82150776) is 2-[2-(3,4-dimethylphenyl)-6-methylimidazo[4,5-b]pyridin-3-yl]ethanol.
What is the SMILES notation for 2-[2-(3,4-dimethylphenyl)-6-methylimidazo[4,5-b]pyridin-3-yl]ethanol?
The canonical SMILES for 2-[2-(3,4-dimethylphenyl)-6-methylimidazo[4,5-b]pyridin-3-yl]ethanol is Cc1cnc2c(c1)nc(-c1ccc(C)c(C)c1)n2CCO.
What is the InChIKey of 2-[2-(3,4-dimethylphenyl)-6-methylimidazo[4,5-b]pyridin-3-yl]ethanol?
The InChIKey is CYYUEKWTFSILGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O/c1-11-8-15-17(18-10-11)20(6-7-21)16(19-15)14-5-4-12(2)13(3)9-14/h4-5,8-10,21H,6-7H2,1-3H3.
What are the key properties of 2-[2-(3,4-dimethylphenyl)-6-methylimidazo[4,5-b]pyridin-3-yl]ethanol?
2-[2-(3,4-dimethylphenyl)-6-methylimidazo[4,5-b]pyridin-3-yl]ethanol has a molecular weight of 281.36 g/mol, XLogP of 3.02, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-dimethylphenyl)-6-methylimidazo[4,5-b]pyridin-3-yl]ethanol is sourced from PubChem (CID 82150776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).