C13H17ClN4S — CID 82151206
3-(2-tert-butyl-6-chloroimidazo[4,5-b]pyridin-3-yl)propanethioamide (PubChem CID 82151206) has the molecular formula C13H17ClN4S and a molecular weight of 296.83 g/mol. Its IUPAC name is 3-(2-tert-butyl-6-chloroimidazo[4,5-b]pyridin-3-yl)propanethioamide.
| Compound Name | 3-(2-tert-butyl-6-chloroimidazo[4,5-b]pyridin-3-yl)propanethioamide |
|---|---|
| PubChem CID | 82151206 |
| Molecular Formula | C13H17ClN4S |
| Molecular Weight | 296.83 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 3-(2-tert-butyl-6-chloroimidazo[4,5-b]pyridin-3-yl)propanethioamide |
| SMILES | CC(C)(C)c1nc2cc(Cl)cnc2n1CCC(N)=S |
| InChI | InChI=1S/C13H17ClN4S/c1-13(2,3)12-17-9-6-8(14)7-16-11(9)18(12)5-4-10(15)19/h6-7H,4-5H2,1-3H3,(H2,15,19) |
| InChIKey | OFCPCGHGRVBGMM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.83 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|