About 3-(2,6-dimethylimidazo[4,5-b]pyridin-3-yl)-1-piperazin-1-ylpropan-1-one
3-(2,6-dimethylimidazo[4,5-b]pyridin-3-yl)-1-piperazin-1-ylpropan-1-one (PubChem CID 82151411) has the molecular formula C15H21N5O
and a molecular weight of 287.37 g/mol. Its IUPAC name is 3-(2,6-dimethylimidazo[4,5-b]pyridin-3-yl)-1-piperazin-1-ylpropan-1-one.
Molecular Properties
| Compound Name | 3-(2,6-dimethylimidazo[4,5-b]pyridin-3-yl)-1-piperazin-1-ylpropan-1-one |
| PubChem CID | 82151411 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 3-(2,6-dimethylimidazo[4,5-b]pyridin-3-yl)-1-piperazin-1-ylpropan-1-one |
| SMILES | Cc1cnc2c(c1)nc(C)n2CCC(=O)N1CCNCC1 |
| InChI | InChI=1S/C15H21N5O/c1-11-9-13-15(17-10-11)20(12(2)18-13)6-3-14(21)19-7-4-16-5-8-19/h9-10,16H,3-8H2,1-2H3 |
| InChIKey | NLZFPZUADIMBGF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2,6-dimethylimidazo[4,5-b]pyridin-3-yl)-1-piperazin-1-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dimethylimidazo[4,5-b]pyridin-3-yl)-1-piperazin-1-ylpropan-1-one?
The IUPAC name of 3-(2,6-dimethylimidazo[4,5-b]pyridin-3-yl)-1-piperazin-1-ylpropan-1-one (CID 82151411) is 3-(2,6-dimethylimidazo[4,5-b]pyridin-3-yl)-1-piperazin-1-ylpropan-1-one.
What is the SMILES notation for 3-(2,6-dimethylimidazo[4,5-b]pyridin-3-yl)-1-piperazin-1-ylpropan-1-one?
The canonical SMILES for 3-(2,6-dimethylimidazo[4,5-b]pyridin-3-yl)-1-piperazin-1-ylpropan-1-one is Cc1cnc2c(c1)nc(C)n2CCC(=O)N1CCNCC1.
What is the InChIKey of 3-(2,6-dimethylimidazo[4,5-b]pyridin-3-yl)-1-piperazin-1-ylpropan-1-one?
The InChIKey is NLZFPZUADIMBGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N5O/c1-11-9-13-15(17-10-11)20(12(2)18-13)6-3-14(21)19-7-4-16-5-8-19/h9-10,16H,3-8H2,1-2H3.
What are the key properties of 3-(2,6-dimethylimidazo[4,5-b]pyridin-3-yl)-1-piperazin-1-ylpropan-1-one?
3-(2,6-dimethylimidazo[4,5-b]pyridin-3-yl)-1-piperazin-1-ylpropan-1-one has a molecular weight of 287.37 g/mol, XLogP of 0.87, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dimethylimidazo[4,5-b]pyridin-3-yl)-1-piperazin-1-ylpropan-1-one is sourced from PubChem (CID 82151411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).