C16H20N2O2S — CID 82151792
2-methyl-3-(1-oxo-6-propoxyisoquinolin-2-yl)propanethioamide (PubChem CID 82151792) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-methyl-3-(1-oxo-6-propoxyisoquinolin-2-yl)propanethioamide.
| Compound Name | 2-methyl-3-(1-oxo-6-propoxyisoquinolin-2-yl)propanethioamide |
|---|---|
| PubChem CID | 82151792 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-methyl-3-(1-oxo-6-propoxyisoquinolin-2-yl)propanethioamide |
| SMILES | CCCOc1ccc2c(=O)n(CC(C)C(N)=S)ccc2c1 |
| InChI | InChI=1S/C16H20N2O2S/c1-3-8-20-13-4-5-14-12(9-13)6-7-18(16(14)19)10-11(2)15(17)21/h4-7,9,11H,3,8,10H2,1-2H3,(H2,17,21) |
| InChIKey | AVWDCWWROQGZQO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|