About (2R,5R)-thiolane-2,5-dicarboxylic acid
(2R,5R)-thiolane-2,5-dicarboxylic acid (PubChem CID 821524) has the molecular formula C6H8O4S
and a molecular weight of 176.19 g/mol. Its IUPAC name is (2R,5R)-thiolane-2,5-dicarboxylic acid.
Molecular Properties
| Compound Name | (2R,5R)-thiolane-2,5-dicarboxylic acid |
| PubChem CID | 821524 |
| Molecular Formula | C6H8O4S |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.01 |
| IUPAC Name | (2R,5R)-thiolane-2,5-dicarboxylic acid |
| SMILES | O=C(O)[C@H]1CC[C@H](C(=O)O)S1 |
| InChI | InChI=1S/C6H8O4S/c7-5(8)3-1-2-4(11-3)6(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10)/t3-,4-/m1/s1 |
| InChIKey | VZKPHLAASBCFGX-QWWZWVQMSA-N |
| XLogP | 0.42 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,5R)-thiolane-2,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-thiolane-2,5-dicarboxylic acid?
The IUPAC name of (2R,5R)-thiolane-2,5-dicarboxylic acid (CID 821524) is (2R,5R)-thiolane-2,5-dicarboxylic acid.
What is the SMILES notation for (2R,5R)-thiolane-2,5-dicarboxylic acid?
The canonical SMILES for (2R,5R)-thiolane-2,5-dicarboxylic acid is O=C(O)[C@H]1CC[C@H](C(=O)O)S1.
What is the InChIKey of (2R,5R)-thiolane-2,5-dicarboxylic acid?
The InChIKey is VZKPHLAASBCFGX-QWWZWVQMSA-N. The full InChI is InChI=1S/C6H8O4S/c7-5(8)3-1-2-4(11-3)6(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10)/t3-,4-/m1/s1.
What are the key properties of (2R,5R)-thiolane-2,5-dicarboxylic acid?
(2R,5R)-thiolane-2,5-dicarboxylic acid has a molecular weight of 176.19 g/mol, XLogP of 0.42, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-thiolane-2,5-dicarboxylic acid is sourced from PubChem (CID 821524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).