C19H25N3O2 — CID 82153720
3-[3-amino-4-(3-methylbutoxy)phenyl]-N-pyridin-3-ylpropanamide (PubChem CID 82153720) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 3-[3-amino-4-(3-methylbutoxy)phenyl]-N-pyridin-3-ylpropanamide.
| Compound Name | 3-[3-amino-4-(3-methylbutoxy)phenyl]-N-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 82153720 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 3-[3-amino-4-(3-methylbutoxy)phenyl]-N-pyridin-3-ylpropanamide |
| SMILES | CC(C)CCOc1ccc(CCC(=O)Nc2cccnc2)cc1N |
| InChI | InChI=1S/C19H25N3O2/c1-14(2)9-11-24-18-7-5-15(12-17(18)20)6-8-19(23)22-16-4-3-10-21-13-16/h3-5,7,10,12-14H,6,8-9,11,20H2,1-2H3,(H,22,23) |
| InChIKey | ALMJJJRKDSJISJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|