C14H14FNO3S — CID 82154126
2-[3-(3-fluorophenoxy)propyl]-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 82154126) has the molecular formula C14H14FNO3S and a molecular weight of 295.33 g/mol. Its IUPAC name is 2-[3-(3-fluorophenoxy)propyl]-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[3-(3-fluorophenoxy)propyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82154126 |
| Molecular Formula | C14H14FNO3S |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-[3-(3-fluorophenoxy)propyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(CCCOc2cccc(F)c2)sc1C(=O)O |
| InChI | InChI=1S/C14H14FNO3S/c1-9-13(14(17)18)20-12(16-9)6-3-7-19-11-5-2-4-10(15)8-11/h2,4-5,8H,3,6-7H2,1H3,(H,17,18) |
| InChIKey | XASPJBTYTDRQQJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|