C8H6Cl3NS — CID 82154868
2-(2,3,6-trichlorophenyl)ethanethioamide (PubChem CID 82154868) has the molecular formula C8H6Cl3NS and a molecular weight of 254.57 g/mol. Its IUPAC name is 2-(2,3,6-trichlorophenyl)ethanethioamide.
| Compound Name | 2-(2,3,6-trichlorophenyl)ethanethioamide |
|---|---|
| PubChem CID | 82154868 |
| Molecular Formula | C8H6Cl3NS |
| Molecular Weight | 254.57 g/mol |
| Exact Mass | 252.93 |
| IUPAC Name | 2-(2,3,6-trichlorophenyl)ethanethioamide |
| SMILES | NC(=S)Cc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C8H6Cl3NS/c9-5-1-2-6(10)8(11)4(5)3-7(12)13/h1-2H,3H2,(H2,12,13) |
| InChIKey | NGGQUBXTLUNMAH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|