C9H11N3O3S2 — CID 82154875
methyl 2-[(3-amino-3-sulfanylidenepropanoyl)amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 82154875) has the molecular formula C9H11N3O3S2 and a molecular weight of 273.34 g/mol. Its IUPAC name is methyl 2-[(3-amino-3-sulfanylidenepropanoyl)amino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(3-amino-3-sulfanylidenepropanoyl)amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 82154875 |
| Molecular Formula | C9H11N3O3S2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | methyl 2-[(3-amino-3-sulfanylidenepropanoyl)amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(NC(=O)CC(N)=S)nc1C |
| InChI | InChI=1S/C9H11N3O3S2/c1-4-7(8(14)15-2)17-9(11-4)12-6(13)3-5(10)16/h3H2,1-2H3,(H2,10,16)(H,11,12,13) |
| InChIKey | DUUIUGFJMBWZSA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|