C15H14N2O5 — CID 82155613
(E)-3-[4-(cyanomethyl)-8-methoxy-2-methyl-3-oxo-1,4-benzoxazin-6-yl]prop-2-enoic acid (PubChem CID 82155613) has the molecular formula C15H14N2O5 and a molecular weight of 302.29 g/mol. Its IUPAC name is (E)-3-[4-(cyanomethyl)-8-methoxy-2-methyl-3-oxo-1,4-benzoxazin-6-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(cyanomethyl)-8-methoxy-2-methyl-3-oxo-1,4-benzoxazin-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82155613 |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (E)-3-[4-(cyanomethyl)-8-methoxy-2-methyl-3-oxo-1,4-benzoxazin-6-yl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)O)cc2c1OC(C)C(=O)N2CC#N |
| InChI | InChI=1S/C15H14N2O5/c1-9-15(20)17(6-5-16)11-7-10(3-4-13(18)19)8-12(21-2)14(11)22-9/h3-4,7-9H,6H2,1-2H3,(H,18,19)/b4-3+ |
| InChIKey | UKSJYFQWQBCEKT-ONEGZZNKSA-N |
| XLogP | 1.43 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|