C16H21NO4 — CID 82155998
6-(hydroxymethyl)-4-(2-methylprop-2-enyl)-8-propoxy-1,4-benzoxazin-3-one (PubChem CID 82155998) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 6-(hydroxymethyl)-4-(2-methylprop-2-enyl)-8-propoxy-1,4-benzoxazin-3-one.
| Compound Name | 6-(hydroxymethyl)-4-(2-methylprop-2-enyl)-8-propoxy-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82155998 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 6-(hydroxymethyl)-4-(2-methylprop-2-enyl)-8-propoxy-1,4-benzoxazin-3-one |
| SMILES | C=C(C)CN1C(=O)COc2c(OCCC)cc(CO)cc21 |
| InChI | InChI=1S/C16H21NO4/c1-4-5-20-14-7-12(9-18)6-13-16(14)21-10-15(19)17(13)8-11(2)3/h6-7,18H,2,4-5,8-10H2,1,3H3 |
| InChIKey | QJIMUDZLEHSXQQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|