C14H12F2N2 — CID 82156513
6,7-difluoro-2-phenyl-1,2,3,4-tetrahydroquinoxaline (PubChem CID 82156513) has the molecular formula C14H12F2N2 and a molecular weight of 246.26 g/mol. Its IUPAC name is 6,7-difluoro-2-phenyl-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 6,7-difluoro-2-phenyl-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 82156513 |
| Molecular Formula | C14H12F2N2 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 6,7-difluoro-2-phenyl-1,2,3,4-tetrahydroquinoxaline |
| SMILES | Fc1cc2c(cc1F)NC(c1ccccc1)CN2 |
| InChI | InChI=1S/C14H12F2N2/c15-10-6-12-13(7-11(10)16)18-14(8-17-12)9-4-2-1-3-5-9/h1-7,14,17-18H,8H2 |
| InChIKey | YVKUZZUJUCTUHL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |