C10H12F2N2 — CID 82156516
2-ethyl-6,7-difluoro-1,2,3,4-tetrahydroquinoxaline (PubChem CID 82156516) has the molecular formula C10H12F2N2 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-ethyl-6,7-difluoro-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 2-ethyl-6,7-difluoro-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 82156516 |
| Molecular Formula | C10H12F2N2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 2-ethyl-6,7-difluoro-1,2,3,4-tetrahydroquinoxaline |
| SMILES | CCC1CNc2cc(F)c(F)cc2N1 |
| InChI | InChI=1S/C10H12F2N2/c1-2-6-5-13-9-3-7(11)8(12)4-10(9)14-6/h3-4,6,13-14H,2,5H2,1H3 |
| InChIKey | UTSVITIFEZSBEO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |