About 4-ethyl-6,7-dimethyl-2,3-dihydro-1H-quinoxaline
4-ethyl-6,7-dimethyl-2,3-dihydro-1H-quinoxaline (PubChem CID 82156538) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-ethyl-6,7-dimethyl-2,3-dihydro-1H-quinoxaline.
Molecular Properties
| Compound Name | 4-ethyl-6,7-dimethyl-2,3-dihydro-1H-quinoxaline |
| PubChem CID | 82156538 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 4-ethyl-6,7-dimethyl-2,3-dihydro-1H-quinoxaline |
| SMILES | CCN1CCNc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C12H18N2/c1-4-14-6-5-13-11-7-9(2)10(3)8-12(11)14/h7-8,13H,4-6H2,1-3H3 |
| InChIKey | JCJPQOSZUWAUQW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-6,7-dimethyl-2,3-dihydro-1H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-6,7-dimethyl-2,3-dihydro-1H-quinoxaline?
The IUPAC name of 4-ethyl-6,7-dimethyl-2,3-dihydro-1H-quinoxaline (CID 82156538) is 4-ethyl-6,7-dimethyl-2,3-dihydro-1H-quinoxaline.
What is the SMILES notation for 4-ethyl-6,7-dimethyl-2,3-dihydro-1H-quinoxaline?
The canonical SMILES for 4-ethyl-6,7-dimethyl-2,3-dihydro-1H-quinoxaline is CCN1CCNc2cc(C)c(C)cc21.
What is the InChIKey of 4-ethyl-6,7-dimethyl-2,3-dihydro-1H-quinoxaline?
The InChIKey is JCJPQOSZUWAUQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2/c1-4-14-6-5-13-11-7-9(2)10(3)8-12(11)14/h7-8,13H,4-6H2,1-3H3.
What are the key properties of 4-ethyl-6,7-dimethyl-2,3-dihydro-1H-quinoxaline?
4-ethyl-6,7-dimethyl-2,3-dihydro-1H-quinoxaline has a molecular weight of 190.29 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-6,7-dimethyl-2,3-dihydro-1H-quinoxaline is sourced from PubChem (CID 82156538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).